About (2E)-N',2-dimethyl-N-(5-methyl-1H-pyrazol-3-yl)penta-2,4-dienimidamide
(2E)-N',2-dimethyl-N-(5-methyl-1H-pyrazol-3-yl)penta-2,4-dienimidamide (PubChem CID 123365554) has the molecular formula C11H16N4
and a molecular weight of 204.28 g/mol. Its IUPAC name is (2E)-N',2-dimethyl-N-(5-methyl-1H-pyrazol-3-yl)penta-2,4-dienimidamide.
Molecular Properties
| Compound Name | (2E)-N',2-dimethyl-N-(5-methyl-1H-pyrazol-3-yl)penta-2,4-dienimidamide |
| PubChem CID | 123365554 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | (2E)-N',2-dimethyl-N-(5-methyl-1H-pyrazol-3-yl)penta-2,4-dienimidamide |
| SMILES | C=C/C=C(C)/C(=N\C)Nc1cc(C)[nH]n1 |
| InChI | InChI=1S/C11H16N4/c1-5-6-8(2)11(12-4)13-10-7-9(3)14-15-10/h5-7H,1H2,2-4H3,(H2,12,13,14,15)/b8-6+ |
| InChIKey | UCTAMSXLQQTQSB-SOFGYWHQSA-N |
| XLogP | 2.29 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N',2-dimethyl-N-(5-methyl-1H-pyrazol-3-yl)penta-2,4-dienimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N',2-dimethyl-N-(5-methyl-1H-pyrazol-3-yl)penta-2,4-dienimidamide?
The IUPAC name of (2E)-N',2-dimethyl-N-(5-methyl-1H-pyrazol-3-yl)penta-2,4-dienimidamide (CID 123365554) is (2E)-N',2-dimethyl-N-(5-methyl-1H-pyrazol-3-yl)penta-2,4-dienimidamide.
What is the SMILES notation for (2E)-N',2-dimethyl-N-(5-methyl-1H-pyrazol-3-yl)penta-2,4-dienimidamide?
The canonical SMILES for (2E)-N',2-dimethyl-N-(5-methyl-1H-pyrazol-3-yl)penta-2,4-dienimidamide is C=C/C=C(C)/C(=N\C)Nc1cc(C)[nH]n1.
What is the InChIKey of (2E)-N',2-dimethyl-N-(5-methyl-1H-pyrazol-3-yl)penta-2,4-dienimidamide?
The InChIKey is UCTAMSXLQQTQSB-SOFGYWHQSA-N. The full InChI is InChI=1S/C11H16N4/c1-5-6-8(2)11(12-4)13-10-7-9(3)14-15-10/h5-7H,1H2,2-4H3,(H2,12,13,14,15)/b8-6+.
What are the key properties of (2E)-N',2-dimethyl-N-(5-methyl-1H-pyrazol-3-yl)penta-2,4-dienimidamide?
(2E)-N',2-dimethyl-N-(5-methyl-1H-pyrazol-3-yl)penta-2,4-dienimidamide has a molecular weight of 204.28 g/mol, XLogP of 2.29, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N',2-dimethyl-N-(5-methyl-1H-pyrazol-3-yl)penta-2,4-dienimidamide is sourced from PubChem (CID 123365554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).