C18H26ClN3O — CID 123365638
1-(5-chloro-4-methyl-2-pyridinyl)-N-cyclohexylpiperidine-4-carboxamide (PubChem CID 123365638) has the molecular formula C18H26ClN3O and a molecular weight of 335.88 g/mol. Its IUPAC name is 1-(5-chloro-4-methyl-2-pyridinyl)-N-cyclohexylpiperidine-4-carboxamide.
| Compound Name | 1-(5-chloro-4-methyl-2-pyridinyl)-N-cyclohexylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 123365638 |
| Molecular Formula | C18H26ClN3O |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 1-(5-chloro-4-methyl-2-pyridinyl)-N-cyclohexylpiperidine-4-carboxamide |
| SMILES | Cc1cc(N2CCC(C(=O)NC3CCCCC3)CC2)ncc1Cl |
| InChI | InChI=1S/C18H26ClN3O/c1-13-11-17(20-12-16(13)19)22-9-7-14(8-10-22)18(23)21-15-5-3-2-4-6-15/h11-12,14-15H,2-10H2,1H3,(H,21,23) |
| InChIKey | HGWUJBADRLDNOD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |