About methyl 6-[4-cyclohexyl-3-(6,7-difluoro-4-oxoquinazolin-3-yl)-2-oxobutyl]pyridine-3-carboxylate
methyl 6-[4-cyclohexyl-3-(6,7-difluoro-4-oxoquinazolin-3-yl)-2-oxobutyl]pyridine-3-carboxylate (PubChem CID 123365806) has the molecular formula C25H25F2N3O4
and a molecular weight of 469.49 g/mol. Its IUPAC name is methyl 6-[4-cyclohexyl-3-(6,7-difluoro-4-oxoquinazolin-3-yl)-2-oxobutyl]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[4-cyclohexyl-3-(6,7-difluoro-4-oxoquinazolin-3-yl)-2-oxobutyl]pyridine-3-carboxylate |
| PubChem CID | 123365806 |
| Molecular Formula | C25H25F2N3O4 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | methyl 6-[4-cyclohexyl-3-(6,7-difluoro-4-oxoquinazolin-3-yl)-2-oxobutyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(CC(=O)C(CC2CCCCC2)n2cnc3cc(F)c(F)cc3c2=O)nc1 |
| InChI | InChI=1S/C25H25F2N3O4/c1-34-25(33)16-7-8-17(28-13-16)10-23(31)22(9-15-5-3-2-4-6-15)30-14-29-21-12-20(27)19(26)11-18(21)24(30)32/h7-8,11-15,22H,2-6,9-10H2,1H3 |
| InChIKey | KYKBLCPDVRUEKS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 6-[4-cyclohexyl-3-(6,7-difluoro-4-oxoquinazolin-3-yl)-2-oxobutyl]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[4-cyclohexyl-3-(6,7-difluoro-4-oxoquinazolin-3-yl)-2-oxobutyl]pyridine-3-carboxylate?
The IUPAC name of methyl 6-[4-cyclohexyl-3-(6,7-difluoro-4-oxoquinazolin-3-yl)-2-oxobutyl]pyridine-3-carboxylate (CID 123365806) is methyl 6-[4-cyclohexyl-3-(6,7-difluoro-4-oxoquinazolin-3-yl)-2-oxobutyl]pyridine-3-carboxylate.
What is the SMILES notation for methyl 6-[4-cyclohexyl-3-(6,7-difluoro-4-oxoquinazolin-3-yl)-2-oxobutyl]pyridine-3-carboxylate?
The canonical SMILES for methyl 6-[4-cyclohexyl-3-(6,7-difluoro-4-oxoquinazolin-3-yl)-2-oxobutyl]pyridine-3-carboxylate is COC(=O)c1ccc(CC(=O)C(CC2CCCCC2)n2cnc3cc(F)c(F)cc3c2=O)nc1.
What is the InChIKey of methyl 6-[4-cyclohexyl-3-(6,7-difluoro-4-oxoquinazolin-3-yl)-2-oxobutyl]pyridine-3-carboxylate?
The InChIKey is KYKBLCPDVRUEKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25F2N3O4/c1-34-25(33)16-7-8-17(28-13-16)10-23(31)22(9-15-5-3-2-4-6-15)30-14-29-21-12-20(27)19(26)11-18(21)24(30)32/h7-8,11-15,22H,2-6,9-10H2,1H3.
What are the key properties of methyl 6-[4-cyclohexyl-3-(6,7-difluoro-4-oxoquinazolin-3-yl)-2-oxobutyl]pyridine-3-carboxylate?
methyl 6-[4-cyclohexyl-3-(6,7-difluoro-4-oxoquinazolin-3-yl)-2-oxobutyl]pyridine-3-carboxylate has a molecular weight of 469.49 g/mol, XLogP of 4.18, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[4-cyclohexyl-3-(6,7-difluoro-4-oxoquinazolin-3-yl)-2-oxobutyl]pyridine-3-carboxylate is sourced from PubChem (CID 123365806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).