C58H41N7O4 — CID 123366072
4-[10-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-15-(4-isocyanophenyl)-20-(4-methoxyphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzonitrile (PubChem CID 123366072) has the molecular formula C58H41N7O4 and a molecular weight of 900.01 g/mol. Its IUPAC name is 4-[10-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-15-(4-isocyanophenyl)-20-(4-methoxyphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzonitrile.
| Compound Name | 4-[10-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-15-(4-isocyanophenyl)-20-(4-methoxyphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 123366072 |
| Molecular Formula | C58H41N7O4 |
| Molecular Weight | 900.01 g/mol |
| Exact Mass | 899.32 |
| IUPAC Name | 4-[10-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]phenyl]-15-(4-isocyanophenyl)-20-(4-methoxyphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(C2=c3ccc([nH]3)=C(c3ccc(OCCCN4C(=O)c5ccccc5C4=O)cc3)c3ccc([nH]3)C(c3ccc(C#N)cc3)=c3ccc([nH]3)=C(c3ccc(OC)cc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C58H41N7O4/c1-60-40-18-12-37(13-19-40)54-47-26-30-50(63-47)55(38-14-20-41(68-2)21-15-38)49-28-24-45(61-49)53(36-10-8-35(34-59)9-11-36)46-25-29-51(62-46)56(52-31-27-48(54)64-52)39-16-22-42(23-17-39)69-33-5-32-65-57(66)43-6-3-4-7-44(43)58(65)67/h3-4,6-31,61-64H,5,32-33H2,2H3 |
| InChIKey | FZRAHSTXSLJBHO-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 147.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.01 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|