C12H18F3N — CID 123366710
3,5-dimethyl-1-(2,2,2-trifluoroethyl)-3a,4,5,6,7,7a-hexahydroindole (PubChem CID 123366710) has the molecular formula C12H18F3N and a molecular weight of 233.28 g/mol. Its IUPAC name is 3,5-dimethyl-1-(2,2,2-trifluoroethyl)-3a,4,5,6,7,7a-hexahydroindole.
| Compound Name | 3,5-dimethyl-1-(2,2,2-trifluoroethyl)-3a,4,5,6,7,7a-hexahydroindole |
|---|---|
| PubChem CID | 123366710 |
| Molecular Formula | C12H18F3N |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 3,5-dimethyl-1-(2,2,2-trifluoroethyl)-3a,4,5,6,7,7a-hexahydroindole |
| SMILES | CC1=CN(CC(F)(F)F)C2CCC(C)CC12 |
| InChI | InChI=1S/C12H18F3N/c1-8-3-4-11-10(5-8)9(2)6-16(11)7-12(13,14)15/h6,8,10-11H,3-5,7H2,1-2H3 |
| InChIKey | GUTYOQDHRJLCHL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |