C28H40O3 — CID 123366813
4-(methoxymethyl)-7-[2-[5-(2,2,5,5-tetramethylhexan-3-yl)cyclohepta-1,4,6-trien-1-yl]oxyethoxy]cyclohepta-1,2,4,6-tetraene (PubChem CID 123366813) has the molecular formula C28H40O3 and a molecular weight of 424.63 g/mol. Its IUPAC name is 4-(methoxymethyl)-7-[2-[5-(2,2,5,5-tetramethylhexan-3-yl)cyclohepta-1,4,6-trien-1-yl]oxyethoxy]cyclohepta-1,2,4,6-tetraene.
| Compound Name | 4-(methoxymethyl)-7-[2-[5-(2,2,5,5-tetramethylhexan-3-yl)cyclohepta-1,4,6-trien-1-yl]oxyethoxy]cyclohepta-1,2,4,6-tetraene |
|---|---|
| PubChem CID | 123366813 |
| Molecular Formula | C28H40O3 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | 4-(methoxymethyl)-7-[2-[5-(2,2,5,5-tetramethylhexan-3-yl)cyclohepta-1,4,6-trien-1-yl]oxyethoxy]cyclohepta-1,2,4,6-tetraene |
| SMILES | COCC1=CC=C(OCCOC2=CCC=C(C(CC(C)(C)C)C(C)(C)C)C=C2)C=C=C1 |
| InChI | InChI=1S/C28H40O3/c1-27(2,3)20-26(28(4,5)6)23-11-9-13-25(17-15-23)31-19-18-30-24-12-8-10-22(14-16-24)21-29-7/h10-17,26H,9,18-21H2,1-7H3 |
| InChIKey | SULCEWAWHRCGJA-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|