About 2-chloro-6-methylidene-N-prop-1-en-2-yldeca-1,3-dien-5-imine
2-chloro-6-methylidene-N-prop-1-en-2-yldeca-1,3-dien-5-imine (PubChem CID 123366899) has the molecular formula C14H20ClN
and a molecular weight of 237.77 g/mol. Its IUPAC name is 2-chloro-6-methylidene-N-prop-1-en-2-yldeca-1,3-dien-5-imine.
Molecular Properties
| Compound Name | 2-chloro-6-methylidene-N-prop-1-en-2-yldeca-1,3-dien-5-imine |
| PubChem CID | 123366899 |
| Molecular Formula | C14H20ClN |
| Molecular Weight | 237.77 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 2-chloro-6-methylidene-N-prop-1-en-2-yldeca-1,3-dien-5-imine |
| SMILES | C=C(Cl)C=C/C(=N\C(=C)C)C(=C)CCCC |
| InChI | InChI=1S/C14H20ClN/c1-6-7-8-12(4)14(16-11(2)3)10-9-13(5)15/h9-10H,2,4-8H2,1,3H3/b10-9?,16-14+ |
| InChIKey | OZXJIOYJILVDRZ-AMKHYLSESA-N |
| XLogP | 5.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 237.77 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-methylidene-N-prop-1-en-2-yldeca-1,3-dien-5-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-methylidene-N-prop-1-en-2-yldeca-1,3-dien-5-imine?
The IUPAC name of 2-chloro-6-methylidene-N-prop-1-en-2-yldeca-1,3-dien-5-imine (CID 123366899) is 2-chloro-6-methylidene-N-prop-1-en-2-yldeca-1,3-dien-5-imine.
What is the SMILES notation for 2-chloro-6-methylidene-N-prop-1-en-2-yldeca-1,3-dien-5-imine?
The canonical SMILES for 2-chloro-6-methylidene-N-prop-1-en-2-yldeca-1,3-dien-5-imine is C=C(Cl)C=C/C(=N\C(=C)C)C(=C)CCCC.
What is the InChIKey of 2-chloro-6-methylidene-N-prop-1-en-2-yldeca-1,3-dien-5-imine?
The InChIKey is OZXJIOYJILVDRZ-AMKHYLSESA-N. The full InChI is InChI=1S/C14H20ClN/c1-6-7-8-12(4)14(16-11(2)3)10-9-13(5)15/h9-10H,2,4-8H2,1,3H3/b10-9?,16-14+.
What are the key properties of 2-chloro-6-methylidene-N-prop-1-en-2-yldeca-1,3-dien-5-imine?
2-chloro-6-methylidene-N-prop-1-en-2-yldeca-1,3-dien-5-imine has a molecular weight of 237.77 g/mol, XLogP of 5.02, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-methylidene-N-prop-1-en-2-yldeca-1,3-dien-5-imine is sourced from PubChem (CID 123366899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).