C12H28N4Si4 — CID 123366991
1,2,8,8-tetrakis(ethenyl)-2,3,4,4-tetramethyl-1,3,5,7,2,4,6,8-tetrazatetrasilocane (PubChem CID 123366991) has the molecular formula C12H28N4Si4 and a molecular weight of 340.73 g/mol. Its IUPAC name is 1,2,8,8-tetrakis(ethenyl)-2,3,4,4-tetramethyl-1,3,5,7,2,4,6,8-tetrazatetrasilocane.
| Compound Name | 1,2,8,8-tetrakis(ethenyl)-2,3,4,4-tetramethyl-1,3,5,7,2,4,6,8-tetrazatetrasilocane |
|---|---|
| PubChem CID | 123366991 |
| Molecular Formula | C12H28N4Si4 |
| Molecular Weight | 340.73 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1,2,8,8-tetrakis(ethenyl)-2,3,4,4-tetramethyl-1,3,5,7,2,4,6,8-tetrazatetrasilocane |
| SMILES | C=CN1[Si](C=C)(C=C)N[SiH2]N[Si](C)(C)N(C)[Si]1(C)C=C |
| InChI | InChI=1S/C12H28N4Si4/c1-9-16-19(8,10-2)15(5)18(6,7)13-17-14-20(16,11-3)12-4/h9-14H,1-4,17H2,5-8H3 |
| InChIKey | DGXRSBJDDAOBEF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.73 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|