C15H23NO — CID 123367070
3-(4,8-dimethylnona-3,7-dienyl)-5-methyl-1,2-oxazole (PubChem CID 123367070) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 3-(4,8-dimethylnona-3,7-dienyl)-5-methyl-1,2-oxazole.
| Compound Name | 3-(4,8-dimethylnona-3,7-dienyl)-5-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 123367070 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 3-(4,8-dimethylnona-3,7-dienyl)-5-methyl-1,2-oxazole |
| SMILES | CC(C)=CCCC(C)=CCCc1cc(C)on1 |
| InChI | InChI=1S/C15H23NO/c1-12(2)7-5-8-13(3)9-6-10-15-11-14(4)17-16-15/h7,9,11H,5-6,8,10H2,1-4H3 |
| InChIKey | FNCXKGCQWFWUKA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|