About 5-ethyl-7-methyl-7H-cyclohepta[d][1,3]oxazole
5-ethyl-7-methyl-7H-cyclohepta[d][1,3]oxazole (PubChem CID 123367632) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 5-ethyl-7-methyl-7H-cyclohepta[d][1,3]oxazole.
Molecular Properties
| Compound Name | 5-ethyl-7-methyl-7H-cyclohepta[d][1,3]oxazole |
| PubChem CID | 123367632 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 5-ethyl-7-methyl-7H-cyclohepta[d][1,3]oxazole |
| SMILES | CCC1=CC(C)C=c2ocnc2=C1 |
| InChI | InChI=1S/C11H13NO/c1-3-9-4-8(2)5-11-10(6-9)12-7-13-11/h4-8H,3H2,1-2H3 |
| InChIKey | BNYBYUWKMSYLPD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-7-methyl-7H-cyclohepta[d][1,3]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-7-methyl-7H-cyclohepta[d][1,3]oxazole?
The IUPAC name of 5-ethyl-7-methyl-7H-cyclohepta[d][1,3]oxazole (CID 123367632) is 5-ethyl-7-methyl-7H-cyclohepta[d][1,3]oxazole.
What is the SMILES notation for 5-ethyl-7-methyl-7H-cyclohepta[d][1,3]oxazole?
The canonical SMILES for 5-ethyl-7-methyl-7H-cyclohepta[d][1,3]oxazole is CCC1=CC(C)C=c2ocnc2=C1.
What is the InChIKey of 5-ethyl-7-methyl-7H-cyclohepta[d][1,3]oxazole?
The InChIKey is BNYBYUWKMSYLPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-3-9-4-8(2)5-11-10(6-9)12-7-13-11/h4-8H,3H2,1-2H3.
What are the key properties of 5-ethyl-7-methyl-7H-cyclohepta[d][1,3]oxazole?
5-ethyl-7-methyl-7H-cyclohepta[d][1,3]oxazole has a molecular weight of 175.23 g/mol, XLogP of 1.22, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-7-methyl-7H-cyclohepta[d][1,3]oxazole is sourced from PubChem (CID 123367632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).