About 2,2-dichloroethoxysilane
2,2-dichloroethoxysilane (PubChem CID 123367917) has the molecular formula C2H6Cl2OSi
and a molecular weight of 145.06 g/mol. Its IUPAC name is 2,2-dichloroethoxysilane.
Molecular Properties
| Compound Name | 2,2-dichloroethoxysilane |
| PubChem CID | 123367917 |
| Molecular Formula | C2H6Cl2OSi |
| Molecular Weight | 145.06 g/mol |
| Exact Mass | 143.96 |
| IUPAC Name | 2,2-dichloroethoxysilane |
| SMILES | [SiH3]OCC(Cl)Cl |
| InChI | InChI=1S/C2H6Cl2OSi/c3-2(4)1-5-6/h2H,1H2,6H3 |
| InChIKey | IIVHXONOSRMDQR-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.06 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloroethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloroethoxysilane?
The IUPAC name of 2,2-dichloroethoxysilane (CID 123367917) is 2,2-dichloroethoxysilane.
What is the SMILES notation for 2,2-dichloroethoxysilane?
The canonical SMILES for 2,2-dichloroethoxysilane is [SiH3]OCC(Cl)Cl.
What is the InChIKey of 2,2-dichloroethoxysilane?
The InChIKey is IIVHXONOSRMDQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6Cl2OSi/c3-2(4)1-5-6/h2H,1H2,6H3.
What are the key properties of 2,2-dichloroethoxysilane?
2,2-dichloroethoxysilane has a molecular weight of 145.06 g/mol, XLogP of 0.09, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloroethoxysilane is sourced from PubChem (CID 123367917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).