About 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-4,4-dimethylpentanal
3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-4,4-dimethylpentanal (PubChem CID 123367991) has the molecular formula C11H15ClFN3O
and a molecular weight of 259.71 g/mol. Its IUPAC name is 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-4,4-dimethylpentanal.
Molecular Properties
| Compound Name | 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-4,4-dimethylpentanal |
| PubChem CID | 123367991 |
| Molecular Formula | C11H15ClFN3O |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-4,4-dimethylpentanal |
| SMILES | CC(C)(C)C(CC=O)Nc1nc(Cl)ncc1F |
| InChI | InChI=1S/C11H15ClFN3O/c1-11(2,3)8(4-5-17)15-9-7(13)6-14-10(12)16-9/h5-6,8H,4H2,1-3H3,(H,14,15,16) |
| InChIKey | ACKYPBMCXVIWBA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-4,4-dimethylpentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-4,4-dimethylpentanal?
The IUPAC name of 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-4,4-dimethylpentanal (CID 123367991) is 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-4,4-dimethylpentanal.
What is the SMILES notation for 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-4,4-dimethylpentanal?
The canonical SMILES for 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-4,4-dimethylpentanal is CC(C)(C)C(CC=O)Nc1nc(Cl)ncc1F.
What is the InChIKey of 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-4,4-dimethylpentanal?
The InChIKey is ACKYPBMCXVIWBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClFN3O/c1-11(2,3)8(4-5-17)15-9-7(13)6-14-10(12)16-9/h5-6,8H,4H2,1-3H3,(H,14,15,16).
What are the key properties of 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-4,4-dimethylpentanal?
3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-4,4-dimethylpentanal has a molecular weight of 259.71 g/mol, XLogP of 2.68, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-4,4-dimethylpentanal is sourced from PubChem (CID 123367991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).