C12H19F2NO4 — CID 123368397
2-(2,2-difluoropent-4-enoxycarbonylamino)-3,3-dimethylbutanoic acid (PubChem CID 123368397) has the molecular formula C12H19F2NO4 and a molecular weight of 279.28 g/mol. Its IUPAC name is 2-(2,2-difluoropent-4-enoxycarbonylamino)-3,3-dimethylbutanoic acid.
| Compound Name | 2-(2,2-difluoropent-4-enoxycarbonylamino)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 123368397 |
| Molecular Formula | C12H19F2NO4 |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-(2,2-difluoropent-4-enoxycarbonylamino)-3,3-dimethylbutanoic acid |
| SMILES | C=CCC(F)(F)COC(=O)NC(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C12H19F2NO4/c1-5-6-12(13,14)7-19-10(18)15-8(9(16)17)11(2,3)4/h5,8H,1,6-7H2,2-4H3,(H,15,18)(H,16,17) |
| InChIKey | QFAVJIIBFLUIQR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|