C31H36N2O4 — CID 123368580
6-[15-(dimethylamino)-13,14-dihydroxy-6-methyl-20-oxahexacyclo[15.2.1.01,9.02,6.010,12.012,17]icosa-4,8-dien-5-yl]-2H-isoquinolin-1-one (PubChem CID 123368580) has the molecular formula C31H36N2O4 and a molecular weight of 500.64 g/mol. Its IUPAC name is 6-[15-(dimethylamino)-13,14-dihydroxy-6-methyl-20-oxahexacyclo[15.2.1.01,9.02,6.010,12.012,17]icosa-4,8-dien-5-yl]-2H-isoquinolin-1-one.
| Compound Name | 6-[15-(dimethylamino)-13,14-dihydroxy-6-methyl-20-oxahexacyclo[15.2.1.01,9.02,6.010,12.012,17]icosa-4,8-dien-5-yl]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 123368580 |
| Molecular Formula | C31H36N2O4 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | 6-[15-(dimethylamino)-13,14-dihydroxy-6-methyl-20-oxahexacyclo[15.2.1.01,9.02,6.010,12.012,17]icosa-4,8-dien-5-yl]-2H-isoquinolin-1-one |
| SMILES | CN(C)C1CC23CCC4(O2)C(=CCC2(C)C(c5ccc6c(=O)[nH]ccc6c5)=CCC24)C2CC23C(O)C1O |
| InChI | InChI=1S/C31H36N2O4/c1-28-10-8-21-22-15-30(22)26(35)25(34)23(33(2)3)16-29(30)11-12-31(21,37-29)24(28)7-6-20(28)18-4-5-19-17(14-18)9-13-32-27(19)36/h4-6,8-9,13-14,22-26,34-35H,7,10-12,15-16H2,1-3H3,(H,32,36) |
| InChIKey | OBOWYWUDRLQYLY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|