C27H45FN4O4Si2 — CID 123368983
6-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]-2-fluorospiro[2.5]octane-2-carboxylic acid (PubChem CID 123368983) has the molecular formula C27H45FN4O4Si2 and a molecular weight of 564.85 g/mol. Its IUPAC name is 6-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]-2-fluorospiro[2.5]octane-2-carboxylic acid.
| Compound Name | 6-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]-2-fluorospiro[2.5]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 123368983 |
| Molecular Formula | C27H45FN4O4Si2 |
| Molecular Weight | 564.85 g/mol |
| Exact Mass | 564.30 |
| IUPAC Name | 6-[7-[bis(2-trimethylsilylethoxymethyl)amino]pyrazolo[1,5-a]pyrimidin-5-yl]-2-fluorospiro[2.5]octane-2-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(C2CCC3(CC2)CC3(F)C(=O)O)nc2ccnn12 |
| InChI | InChI=1S/C27H45FN4O4Si2/c1-37(2,3)15-13-35-19-31(20-36-14-16-38(4,5)6)24-17-22(30-23-9-12-29-32(23)24)21-7-10-26(11-8-21)18-27(26,28)25(33)34/h9,12,17,21H,7-8,10-11,13-16,18-20H2,1-6H3,(H,33,34) |
| InChIKey | SGGQBUYQKMXNAH-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.85 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|