C14H12F3N3O5S — CID 123368987
2-phenyl-3-(trifluoromethylsulfonyloxy)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylic acid (PubChem CID 123368987) has the molecular formula C14H12F3N3O5S and a molecular weight of 391.33 g/mol. Its IUPAC name is 2-phenyl-3-(trifluoromethylsulfonyloxy)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylic acid.
| Compound Name | 2-phenyl-3-(trifluoromethylsulfonyloxy)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 123368987 |
| Molecular Formula | C14H12F3N3O5S |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 2-phenyl-3-(trifluoromethylsulfonyloxy)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylic acid |
| SMILES | O=C(O)N1CCc2nn(-c3ccccc3)c(OS(=O)(=O)C(F)(F)F)c2C1 |
| InChI | InChI=1S/C14H12F3N3O5S/c15-14(16,17)26(23,24)25-12-10-8-19(13(21)22)7-6-11(10)18-20(12)9-4-2-1-3-5-9/h1-5H,6-8H2,(H,21,22) |
| InChIKey | ZRYUVNUNHOIKNW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|