C30H31F6N7O2 — CID 123368993
N-[1-[3-[3-[amino(hydroxy)amino]-4-fluorophenyl]-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]-2-[4-(butylaminomethyl)-3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 123368993) has the molecular formula C30H31F6N7O2 and a molecular weight of 635.61 g/mol. Its IUPAC name is N-[1-[3-[3-[amino(hydroxy)amino]-4-fluorophenyl]-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]-2-[4-(butylaminomethyl)-3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-[1-[3-[3-[amino(hydroxy)amino]-4-fluorophenyl]-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]-2-[4-(butylaminomethyl)-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 123368993 |
| Molecular Formula | C30H31F6N7O2 |
| Molecular Weight | 635.61 g/mol |
| Exact Mass | 635.24 |
| IUPAC Name | N-[1-[3-[3-[amino(hydroxy)amino]-4-fluorophenyl]-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]-2-[4-(butylaminomethyl)-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | CCCCNCc1cn(CC(=O)NC(Cc2cc(F)cc(F)c2)c2ncccc2-c2ccc(F)c(N(N)O)c2)nc1C(F)(F)F |
| InChI | InChI=1S/C30H31F6N7O2/c1-2-3-8-38-15-20-16-42(41-29(20)30(34,35)36)17-27(44)40-25(12-18-10-21(31)14-22(32)11-18)28-23(5-4-9-39-28)19-6-7-24(33)26(13-19)43(37)45/h4-7,9-11,13-14,16,25,38,45H,2-3,8,12,15,17,37H2,1H3,(H,40,44) |
| InChIKey | DKAYHRNJEFZAAR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 121.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.61 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|