C40H65F3N2O2 — CID 123369189
3-imino-3-[3-(6-methylhept-5-en-3-yl)-5-(trifluoromethyl)cyclohexyl]-1-[4-methyl-3-[3-methyl-6-(oxan-4-ylmethyl)-3a,4,5,6,7,7a-hexahydro-1H-isoindol-1-yl]cyclohexyl]propan-1-ol (PubChem CID 123369189) has the molecular formula C40H65F3N2O2 and a molecular weight of 662.97 g/mol. Its IUPAC name is 3-imino-3-[3-(6-methylhept-5-en-3-yl)-5-(trifluoromethyl)cyclohexyl]-1-[4-methyl-3-[3-methyl-6-(oxan-4-ylmethyl)-3a,4,5,6,7,7a-hexahydro-1H-isoindol-1-yl]cyclohexyl]propan-1-ol.
| Compound Name | 3-imino-3-[3-(6-methylhept-5-en-3-yl)-5-(trifluoromethyl)cyclohexyl]-1-[4-methyl-3-[3-methyl-6-(oxan-4-ylmethyl)-3a,4,5,6,7,7a-hexahydro-1H-isoindol-1-yl]cyclohexyl]propan-1-ol |
|---|---|
| PubChem CID | 123369189 |
| Molecular Formula | C40H65F3N2O2 |
| Molecular Weight | 662.97 g/mol |
| Exact Mass | 662.50 |
| IUPAC Name | 3-imino-3-[3-(6-methylhept-5-en-3-yl)-5-(trifluoromethyl)cyclohexyl]-1-[4-methyl-3-[3-methyl-6-(oxan-4-ylmethyl)-3a,4,5,6,7,7a-hexahydro-1H-isoindol-1-yl]cyclohexyl]propan-1-ol |
| SMILES | [H]/N=C(/CC(O)C1CCC(C)C(C2N=C(C)C3CCC(CC4CCOCC4)CC32)C1)C1CC(C(CC)CC=C(C)C)CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C40H65F3N2O2/c1-6-29(10-7-24(2)3)31-19-32(21-33(20-31)40(41,42)43)37(44)23-38(46)30-11-8-25(4)35(22-30)39-36-18-28(9-12-34(36)26(5)45-39)17-27-13-15-47-16-14-27/h7,25,27-36,38-39,44,46H,6,8-23H2,1-5H3/b44-37- |
| InChIKey | UVWAJSVOXTVLPD-LWIPBWEKSA-N |
| XLogP | 10.48 |
| TPSA | 65.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.97 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|