C28H35FN2O4 — CID 123369949
9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-N-(2-pyridin-2-yloxyethyl)-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 123369949) has the molecular formula C28H35FN2O4 and a molecular weight of 482.60 g/mol. Its IUPAC name is 9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-N-(2-pyridin-2-yloxyethyl)-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | 9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-N-(2-pyridin-2-yloxyethyl)-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 123369949 |
| Molecular Formula | C28H35FN2O4 |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | 9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-N-(2-pyridin-2-yloxyethyl)-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1C(=O)NCCOc1ccccn1 |
| InChI | InChI=1S/C28H35FN2O4/c1-17-14-21-20-8-7-18-15-19(32)9-10-27(18,3)28(20,29)22(33)16-26(21,2)24(17)25(34)31-12-13-35-23-6-4-5-11-30-23/h4-6,9-11,15,17,20-22,24,33H,7-8,12-14,16H2,1-3H3,(H,31,34) |
| InChIKey | ZJTGLHQRBIZPEO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|