C17H12ClF3N8 — CID 123369991
5-[2-chloro-3-(trifluoromethyl)phenyl]-7-methyl-10-(1H-pyrazol-5-yl)-3,4,6,9,11,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene (PubChem CID 123369991) has the molecular formula C17H12ClF3N8 and a molecular weight of 420.79 g/mol. Its IUPAC name is 5-[2-chloro-3-(trifluoromethyl)phenyl]-7-methyl-10-(1H-pyrazol-5-yl)-3,4,6,9,11,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene.
| Compound Name | 5-[2-chloro-3-(trifluoromethyl)phenyl]-7-methyl-10-(1H-pyrazol-5-yl)-3,4,6,9,11,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene |
|---|---|
| PubChem CID | 123369991 |
| Molecular Formula | C17H12ClF3N8 |
| Molecular Weight | 420.79 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 5-[2-chloro-3-(trifluoromethyl)phenyl]-7-methyl-10-(1H-pyrazol-5-yl)-3,4,6,9,11,12-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene |
| SMILES | CC1Cn2c(-c3ccn[nH]3)nnc2-c2nnc(-c3cccc(C(F)(F)F)c3Cl)n21 |
| InChI | InChI=1S/C17H12ClF3N8/c1-8-7-28-14(11-5-6-22-23-11)25-26-15(28)16-27-24-13(29(8)16)9-3-2-4-10(12(9)18)17(19,20)21/h2-6,8H,7H2,1H3,(H,22,23) |
| InChIKey | SPSUZMVNWVFTSS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.79 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |