C37H41N5O2 — CID 123370164
6-(benzhydrylideneamino)-2-[4-[1-(4-methoxyphenyl)ethylamino]-8-azaspiro[4.5]decan-8-yl]pyridine-3-carboxamide (PubChem CID 123370164) has the molecular formula C37H41N5O2 and a molecular weight of 587.77 g/mol. Its IUPAC name is 6-(benzhydrylideneamino)-2-[4-[1-(4-methoxyphenyl)ethylamino]-8-azaspiro[4.5]decan-8-yl]pyridine-3-carboxamide.
| Compound Name | 6-(benzhydrylideneamino)-2-[4-[1-(4-methoxyphenyl)ethylamino]-8-azaspiro[4.5]decan-8-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123370164 |
| Molecular Formula | C37H41N5O2 |
| Molecular Weight | 587.77 g/mol |
| Exact Mass | 587.33 |
| IUPAC Name | 6-(benzhydrylideneamino)-2-[4-[1-(4-methoxyphenyl)ethylamino]-8-azaspiro[4.5]decan-8-yl]pyridine-3-carboxamide |
| SMILES | COc1ccc(C(C)NC2CCCC23CCN(c2nc(N=C(c4ccccc4)c4ccccc4)ccc2C(N)=O)CC3)cc1 |
| InChI | InChI=1S/C37H41N5O2/c1-26(27-15-17-30(44-2)18-16-27)39-32-14-9-21-37(32)22-24-42(25-23-37)36-31(35(38)43)19-20-33(41-36)40-34(28-10-5-3-6-11-28)29-12-7-4-8-13-29/h3-8,10-13,15-20,26,32,39H,9,14,21-25H2,1-2H3,(H2,38,43) |
| InChIKey | YNWMGFDYNFQJGO-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.77 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|