C18H23NO4 — CID 123370576
methyl 2-methyl-4-[(2-methyl-4-propan-2-yloxypenta-2,4-dienoyl)amino]benzoate (PubChem CID 123370576) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is methyl 2-methyl-4-[(2-methyl-4-propan-2-yloxypenta-2,4-dienoyl)amino]benzoate.
| Compound Name | methyl 2-methyl-4-[(2-methyl-4-propan-2-yloxypenta-2,4-dienoyl)amino]benzoate |
|---|---|
| PubChem CID | 123370576 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | methyl 2-methyl-4-[(2-methyl-4-propan-2-yloxypenta-2,4-dienoyl)amino]benzoate |
| SMILES | C=C(C=C(C)C(=O)Nc1ccc(C(=O)OC)c(C)c1)OC(C)C |
| InChI | InChI=1S/C18H23NO4/c1-11(2)23-14(5)9-13(4)17(20)19-15-7-8-16(12(3)10-15)18(21)22-6/h7-11H,5H2,1-4,6H3,(H,19,20) |
| InChIKey | RHHBECGXCXIRML-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|