About 7-ethyl-6-(2-ethylpyrazol-3-yl)-1-methylsulfonylquinazoline-2,4-dione
7-ethyl-6-(2-ethylpyrazol-3-yl)-1-methylsulfonylquinazoline-2,4-dione (PubChem CID 123370602) has the molecular formula C16H18N4O4S
and a molecular weight of 362.41 g/mol. Its IUPAC name is 7-ethyl-6-(2-ethylpyrazol-3-yl)-1-methylsulfonylquinazoline-2,4-dione.
Molecular Properties
| Compound Name | 7-ethyl-6-(2-ethylpyrazol-3-yl)-1-methylsulfonylquinazoline-2,4-dione |
| PubChem CID | 123370602 |
| Molecular Formula | C16H18N4O4S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 7-ethyl-6-(2-ethylpyrazol-3-yl)-1-methylsulfonylquinazoline-2,4-dione |
| SMILES | CCc1cc2c(cc1-c1ccnn1CC)c(=O)[nH]c(=O)n2S(C)(=O)=O |
| InChI | InChI=1S/C16H18N4O4S/c1-4-10-8-14-12(9-11(10)13-6-7-17-19(13)5-2)15(21)18-16(22)20(14)25(3,23)24/h6-9H,4-5H2,1-3H3,(H,18,21,22) |
| InChIKey | YCOACFNQCOXKAQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 106.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-ethyl-6-(2-ethylpyrazol-3-yl)-1-methylsulfonylquinazoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-6-(2-ethylpyrazol-3-yl)-1-methylsulfonylquinazoline-2,4-dione?
The IUPAC name of 7-ethyl-6-(2-ethylpyrazol-3-yl)-1-methylsulfonylquinazoline-2,4-dione (CID 123370602) is 7-ethyl-6-(2-ethylpyrazol-3-yl)-1-methylsulfonylquinazoline-2,4-dione.
What is the SMILES notation for 7-ethyl-6-(2-ethylpyrazol-3-yl)-1-methylsulfonylquinazoline-2,4-dione?
The canonical SMILES for 7-ethyl-6-(2-ethylpyrazol-3-yl)-1-methylsulfonylquinazoline-2,4-dione is CCc1cc2c(cc1-c1ccnn1CC)c(=O)[nH]c(=O)n2S(C)(=O)=O.
What is the InChIKey of 7-ethyl-6-(2-ethylpyrazol-3-yl)-1-methylsulfonylquinazoline-2,4-dione?
The InChIKey is YCOACFNQCOXKAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O4S/c1-4-10-8-14-12(9-11(10)13-6-7-17-19(13)5-2)15(21)18-16(22)20(14)25(3,23)24/h6-9H,4-5H2,1-3H3,(H,18,21,22).
What are the key properties of 7-ethyl-6-(2-ethylpyrazol-3-yl)-1-methylsulfonylquinazoline-2,4-dione?
7-ethyl-6-(2-ethylpyrazol-3-yl)-1-methylsulfonylquinazoline-2,4-dione has a molecular weight of 362.41 g/mol, XLogP of 0.94, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-6-(2-ethylpyrazol-3-yl)-1-methylsulfonylquinazoline-2,4-dione is sourced from PubChem (CID 123370602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).