About 3-methyl-3,6-diazabicyclo[3.2.0]hepta-1(7),5-diene
3-methyl-3,6-diazabicyclo[3.2.0]hepta-1(7),5-diene (PubChem CID 123370633) has the molecular formula C6H8N2
and a molecular weight of 108.14 g/mol. Its IUPAC name is 3-methyl-3,6-diazabicyclo[3.2.0]hepta-1(7),5-diene.
Molecular Properties
| Compound Name | 3-methyl-3,6-diazabicyclo[3.2.0]hepta-1(7),5-diene |
| PubChem CID | 123370633 |
| Molecular Formula | C6H8N2 |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.07 |
| IUPAC Name | 3-methyl-3,6-diazabicyclo[3.2.0]hepta-1(7),5-diene |
| SMILES | CN1CC2=CN=C2C1 |
| InChI | InChI=1S/C6H8N2/c1-8-3-5-2-7-6(5)4-8/h2H,3-4H2,1H3 |
| InChIKey | OYUNIHDFQWNALV-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-3,6-diazabicyclo[3.2.0]hepta-1(7),5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3,6-diazabicyclo[3.2.0]hepta-1(7),5-diene?
The IUPAC name of 3-methyl-3,6-diazabicyclo[3.2.0]hepta-1(7),5-diene (CID 123370633) is 3-methyl-3,6-diazabicyclo[3.2.0]hepta-1(7),5-diene.
What is the SMILES notation for 3-methyl-3,6-diazabicyclo[3.2.0]hepta-1(7),5-diene?
The canonical SMILES for 3-methyl-3,6-diazabicyclo[3.2.0]hepta-1(7),5-diene is CN1CC2=CN=C2C1.
What is the InChIKey of 3-methyl-3,6-diazabicyclo[3.2.0]hepta-1(7),5-diene?
The InChIKey is OYUNIHDFQWNALV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2/c1-8-3-5-2-7-6(5)4-8/h2H,3-4H2,1H3.
What are the key properties of 3-methyl-3,6-diazabicyclo[3.2.0]hepta-1(7),5-diene?
3-methyl-3,6-diazabicyclo[3.2.0]hepta-1(7),5-diene has a molecular weight of 108.14 g/mol, XLogP of 0.27, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3,6-diazabicyclo[3.2.0]hepta-1(7),5-diene is sourced from PubChem (CID 123370633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).