About 3-(4-hydroxyphenyl)-2-(4-methylphenyl)-4-(trifluoromethyl)-2,3-dihydrochromene-4,6-diol
3-(4-hydroxyphenyl)-2-(4-methylphenyl)-4-(trifluoromethyl)-2,3-dihydrochromene-4,6-diol (PubChem CID 123370824) has the molecular formula C23H19F3O4
and a molecular weight of 416.40 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-2-(4-methylphenyl)-4-(trifluoromethyl)-2,3-dihydrochromene-4,6-diol.
Molecular Properties
| Compound Name | 3-(4-hydroxyphenyl)-2-(4-methylphenyl)-4-(trifluoromethyl)-2,3-dihydrochromene-4,6-diol |
| PubChem CID | 123370824 |
| Molecular Formula | C23H19F3O4 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 3-(4-hydroxyphenyl)-2-(4-methylphenyl)-4-(trifluoromethyl)-2,3-dihydrochromene-4,6-diol |
| SMILES | Cc1ccc(C2Oc3ccc(O)cc3C(O)(C(F)(F)F)C2c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C23H19F3O4/c1-13-2-4-15(5-3-13)21-20(14-6-8-16(27)9-7-14)22(29,23(24,25)26)18-12-17(28)10-11-19(18)30-21/h2-12,20-21,27-29H,1H3 |
| InChIKey | QSMCYHWVLLUFJY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-hydroxyphenyl)-2-(4-methylphenyl)-4-(trifluoromethyl)-2,3-dihydrochromene-4,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-hydroxyphenyl)-2-(4-methylphenyl)-4-(trifluoromethyl)-2,3-dihydrochromene-4,6-diol?
The IUPAC name of 3-(4-hydroxyphenyl)-2-(4-methylphenyl)-4-(trifluoromethyl)-2,3-dihydrochromene-4,6-diol (CID 123370824) is 3-(4-hydroxyphenyl)-2-(4-methylphenyl)-4-(trifluoromethyl)-2,3-dihydrochromene-4,6-diol.
What is the SMILES notation for 3-(4-hydroxyphenyl)-2-(4-methylphenyl)-4-(trifluoromethyl)-2,3-dihydrochromene-4,6-diol?
The canonical SMILES for 3-(4-hydroxyphenyl)-2-(4-methylphenyl)-4-(trifluoromethyl)-2,3-dihydrochromene-4,6-diol is Cc1ccc(C2Oc3ccc(O)cc3C(O)(C(F)(F)F)C2c2ccc(O)cc2)cc1.
What is the InChIKey of 3-(4-hydroxyphenyl)-2-(4-methylphenyl)-4-(trifluoromethyl)-2,3-dihydrochromene-4,6-diol?
The InChIKey is QSMCYHWVLLUFJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19F3O4/c1-13-2-4-15(5-3-13)21-20(14-6-8-16(27)9-7-14)22(29,23(24,25)26)18-12-17(28)10-11-19(18)30-21/h2-12,20-21,27-29H,1H3.
What are the key properties of 3-(4-hydroxyphenyl)-2-(4-methylphenyl)-4-(trifluoromethyl)-2,3-dihydrochromene-4,6-diol?
3-(4-hydroxyphenyl)-2-(4-methylphenyl)-4-(trifluoromethyl)-2,3-dihydrochromene-4,6-diol has a molecular weight of 416.40 g/mol, XLogP of 5.07, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-hydroxyphenyl)-2-(4-methylphenyl)-4-(trifluoromethyl)-2,3-dihydrochromene-4,6-diol is sourced from PubChem (CID 123370824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).