C23H23FN4OS — CID 123371315
N-[3-(7,8-dihydroquinolin-4-ylmethylcarbamothioylamino)propyl]-3-(2-fluorophenyl)prop-2-ynamide (PubChem CID 123371315) has the molecular formula C23H23FN4OS and a molecular weight of 422.53 g/mol. Its IUPAC name is N-[3-(7,8-dihydroquinolin-4-ylmethylcarbamothioylamino)propyl]-3-(2-fluorophenyl)prop-2-ynamide.
| Compound Name | N-[3-(7,8-dihydroquinolin-4-ylmethylcarbamothioylamino)propyl]-3-(2-fluorophenyl)prop-2-ynamide |
|---|---|
| PubChem CID | 123371315 |
| Molecular Formula | C23H23FN4OS |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-[3-(7,8-dihydroquinolin-4-ylmethylcarbamothioylamino)propyl]-3-(2-fluorophenyl)prop-2-ynamide |
| SMILES | O=C(C#Cc1ccccc1F)NCCCNC(=S)NCc1ccnc2c1C=CCC2 |
| InChI | InChI=1S/C23H23FN4OS/c24-20-8-3-1-6-17(20)10-11-22(29)26-13-5-14-27-23(30)28-16-18-12-15-25-21-9-4-2-7-19(18)21/h1-3,6-8,12,15H,4-5,9,13-14,16H2,(H,26,29)(H2,27,28,30) |
| InChIKey | LSLIDSOCXLQNLE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|