C27H28FN5O3 — CID 123371322
N-(4-fluorophenyl)-2-[(4S)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazin-4-yl]acetamide (PubChem CID 123371322) has the molecular formula C27H28FN5O3 and a molecular weight of 489.55 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[(4S)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazin-4-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[(4S)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazin-4-yl]acetamide |
|---|---|
| PubChem CID | 123371322 |
| Molecular Formula | C27H28FN5O3 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | N-(4-fluorophenyl)-2-[(4S)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazin-4-yl]acetamide |
| SMILES | COc1cc(C=C2CCCN3C2=NOC[C@@H]3CC(=O)Nc2ccc(F)cc2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C27H28FN5O3/c1-18-15-32(17-29-18)24-10-5-19(13-25(24)35-2)12-20-4-3-11-33-23(16-36-31-27(20)33)14-26(34)30-22-8-6-21(28)7-9-22/h5-10,12-13,15,17,23H,3-4,11,14,16H2,1-2H3,(H,30,34)/t23-/m0/s1 |
| InChIKey | KYVXIEXCLZBTMR-QHCPKHFHSA-N |
| XLogP | 4.55 |
| TPSA | 80.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |