About (7-ethynylcyclohepta-1,4,6-trien-1-yl)urea
(7-ethynylcyclohepta-1,4,6-trien-1-yl)urea (PubChem CID 123371352) has the molecular formula C10H10N2O
and a molecular weight of 174.20 g/mol. Its IUPAC name is (7-ethynylcyclohepta-1,4,6-trien-1-yl)urea.
Molecular Properties
| Compound Name | (7-ethynylcyclohepta-1,4,6-trien-1-yl)urea |
| PubChem CID | 123371352 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | (7-ethynylcyclohepta-1,4,6-trien-1-yl)urea |
| SMILES | C#CC1=CC=CCC=C1NC(N)=O |
| InChI | InChI=1S/C10H10N2O/c1-2-8-6-4-3-5-7-9(8)12-10(11)13/h1,3-4,6-7H,5H2,(H3,11,12,13) |
| InChIKey | UAIDXKZHMYQTCQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (7-ethynylcyclohepta-1,4,6-trien-1-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-ethynylcyclohepta-1,4,6-trien-1-yl)urea?
The IUPAC name of (7-ethynylcyclohepta-1,4,6-trien-1-yl)urea (CID 123371352) is (7-ethynylcyclohepta-1,4,6-trien-1-yl)urea.
What is the SMILES notation for (7-ethynylcyclohepta-1,4,6-trien-1-yl)urea?
The canonical SMILES for (7-ethynylcyclohepta-1,4,6-trien-1-yl)urea is C#CC1=CC=CCC=C1NC(N)=O.
What is the InChIKey of (7-ethynylcyclohepta-1,4,6-trien-1-yl)urea?
The InChIKey is UAIDXKZHMYQTCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O/c1-2-8-6-4-3-5-7-9(8)12-10(11)13/h1,3-4,6-7H,5H2,(H3,11,12,13).
What are the key properties of (7-ethynylcyclohepta-1,4,6-trien-1-yl)urea?
(7-ethynylcyclohepta-1,4,6-trien-1-yl)urea has a molecular weight of 174.20 g/mol, XLogP of 1.06, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7-ethynylcyclohepta-1,4,6-trien-1-yl)urea is sourced from PubChem (CID 123371352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).