C29H84O12Si13 — CID 123372510
[1-silyl-2,2-bis[tris(trimethylsilyloxy)silyloxy]ethenyl] tris(trimethylsilyl) silicate (PubChem CID 123372510) has the molecular formula C29H84O12Si13 and a molecular weight of 990.10 g/mol. Its IUPAC name is [1-silyl-2,2-bis[tris(trimethylsilyloxy)silyloxy]ethenyl] tris(trimethylsilyl) silicate.
| Compound Name | [1-silyl-2,2-bis[tris(trimethylsilyloxy)silyloxy]ethenyl] tris(trimethylsilyl) silicate |
|---|---|
| PubChem CID | 123372510 |
| Molecular Formula | C29H84O12Si13 |
| Molecular Weight | 990.10 g/mol |
| Exact Mass | 988.30 |
| IUPAC Name | [1-silyl-2,2-bis[tris(trimethylsilyloxy)silyloxy]ethenyl] tris(trimethylsilyl) silicate |
| SMILES | C[Si](C)(C)O[Si](OC([SiH3])=C(O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C29H84O12Si13/c1-43(2,3)33-52(34-44(4,5)6,35-45(7,8)9)30-28(31-53(36-46(10,11)12,37-47(13,14)15)38-48(16,17)18)29(42)32-54(39-49(19,20)21,40-50(22,23)24)41-51(25,26)27/h1-27,42H3 |
| InChIKey | PMMRFOXAHLOVFX-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 990.10 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|