C62H42N6 — CID 123372670
4-[4-[4-[(4-isocyanocyclohexa-2,4-dien-1-yl)-(9-phenylcarbazol-3-yl)amino]phenyl]-N-(9-phenylcarbazol-3-yl)anilino]benzonitrile (PubChem CID 123372670) has the molecular formula C62H42N6 and a molecular weight of 871.06 g/mol. Its IUPAC name is 4-[4-[4-[(4-isocyanocyclohexa-2,4-dien-1-yl)-(9-phenylcarbazol-3-yl)amino]phenyl]-N-(9-phenylcarbazol-3-yl)anilino]benzonitrile.
| Compound Name | 4-[4-[4-[(4-isocyanocyclohexa-2,4-dien-1-yl)-(9-phenylcarbazol-3-yl)amino]phenyl]-N-(9-phenylcarbazol-3-yl)anilino]benzonitrile |
|---|---|
| PubChem CID | 123372670 |
| Molecular Formula | C62H42N6 |
| Molecular Weight | 871.06 g/mol |
| Exact Mass | 870.35 |
| IUPAC Name | 4-[4-[4-[(4-isocyanocyclohexa-2,4-dien-1-yl)-(9-phenylcarbazol-3-yl)amino]phenyl]-N-(9-phenylcarbazol-3-yl)anilino]benzonitrile |
| SMILES | [C-]#[N+]C1=CCC(N(c2ccc(-c3ccc(N(c4ccc(C#N)cc4)c4ccc5c(c4)c4ccccc4n5-c4ccccc4)cc3)cc2)c2ccc3c(c2)c2ccccc2n3-c2ccccc2)C=C1 |
| InChI | InChI=1S/C62H42N6/c1-64-46-26-34-52(35-27-46)66(54-37-39-62-58(41-54)56-17-9-11-19-60(56)68(62)48-14-6-3-7-15-48)51-32-24-45(25-33-51)44-22-30-50(31-23-44)65(49-28-20-43(42-63)21-29-49)53-36-38-61-57(40-53)55-16-8-10-18-59(55)67(61)47-12-4-2-5-13-47/h2-34,36-41,52H,35H2 |
| InChIKey | GEPBYRKSHVHSQA-UHFFFAOYSA-N |
| XLogP | 16.16 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.06 |
| LogP ≤ 5 | 16.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|