C22H25F6NO — CID 123372701
N-[4-[difluoro-[2-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methyl]cyclohexa-2,4-dien-1-yl]-2-(fluoromethyl)hept-2-enamide (PubChem CID 123372701) has the molecular formula C22H25F6NO and a molecular weight of 433.44 g/mol. Its IUPAC name is N-[4-[difluoro-[2-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methyl]cyclohexa-2,4-dien-1-yl]-2-(fluoromethyl)hept-2-enamide.
| Compound Name | N-[4-[difluoro-[2-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methyl]cyclohexa-2,4-dien-1-yl]-2-(fluoromethyl)hept-2-enamide |
|---|---|
| PubChem CID | 123372701 |
| Molecular Formula | C22H25F6NO |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N-[4-[difluoro-[2-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methyl]cyclohexa-2,4-dien-1-yl]-2-(fluoromethyl)hept-2-enamide |
| SMILES | CCCCC=C(CF)C(=O)NC1C=CC(C(F)(F)C2=C(C(F)(F)F)C=CCC2)=CC1 |
| InChI | InChI=1S/C22H25F6NO/c1-2-3-4-7-15(14-23)20(30)29-17-12-10-16(11-13-17)21(24,25)18-8-5-6-9-19(18)22(26,27)28/h6-7,9-12,17H,2-5,8,13-14H2,1H3,(H,29,30) |
| InChIKey | CXPSCELDUGRCHK-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|