C16H31F3O6Si3 — CID 123372804
5,5,5-trifluoro-3-(2,2,3-trimethyl-1-silyloxysilyl-1-trimethylsilyloxybutoxy)carbonylpent-2-enoic acid (PubChem CID 123372804) has the molecular formula C16H31F3O6Si3 and a molecular weight of 460.67 g/mol. Its IUPAC name is 5,5,5-trifluoro-3-(2,2,3-trimethyl-1-silyloxysilyl-1-trimethylsilyloxybutoxy)carbonylpent-2-enoic acid.
| Compound Name | 5,5,5-trifluoro-3-(2,2,3-trimethyl-1-silyloxysilyl-1-trimethylsilyloxybutoxy)carbonylpent-2-enoic acid |
|---|---|
| PubChem CID | 123372804 |
| Molecular Formula | C16H31F3O6Si3 |
| Molecular Weight | 460.67 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 5,5,5-trifluoro-3-(2,2,3-trimethyl-1-silyloxysilyl-1-trimethylsilyloxybutoxy)carbonylpent-2-enoic acid |
| SMILES | CC(C)C(C)(C)C(OC(=O)C(=CC(=O)O)CC(F)(F)F)(O[Si](C)(C)C)[SiH2]O[SiH3] |
| InChI | InChI=1S/C16H31F3O6Si3/c1-10(2)14(3,4)16(27-25-26,24-28(5,6)7)23-13(22)11(8-12(20)21)9-15(17,18)19/h8,10H,9,27H2,1-7,26H3,(H,20,21) |
| InChIKey | QSXPEMYJEUJBLT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.67 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|