About 3a,4,5,6-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-ol
3a,4,5,6-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-ol (PubChem CID 123372844) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is 3a,4,5,6-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-ol.
Analyze 3a,4,5,6-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,4,5,6-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-ol?
The IUPAC name of 3a,4,5,6-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-ol (CID 123372844) is 3a,4,5,6-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-ol.
What is the SMILES notation for 3a,4,5,6-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-ol?
The canonical SMILES for 3a,4,5,6-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-ol is OC1CCC2=NOCC21.
What is the InChIKey of 3a,4,5,6-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-ol?
The InChIKey is HIAKNZOOEHSOTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c8-6-2-1-5-4(6)3-9-7-5/h4,6,8H,1-3H2.
What are the key properties of 3a,4,5,6-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-ol?
3a,4,5,6-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-ol has a molecular weight of 127.14 g/mol, XLogP of 0.14, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,4,5,6-tetrahydro-3H-cyclopenta[c][1,2]oxazol-4-ol is sourced from PubChem (CID 123372844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).