C14H15N5O3 — CID 123373018
3-[1-(1,3-benzoxazol-2-ylmethyl)-3-methyl-2H-triazol-4-yl]-N-hydroxyprop-2-enamide (PubChem CID 123373018) has the molecular formula C14H15N5O3 and a molecular weight of 301.31 g/mol. Its IUPAC name is 3-[1-(1,3-benzoxazol-2-ylmethyl)-3-methyl-2H-triazol-4-yl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[1-(1,3-benzoxazol-2-ylmethyl)-3-methyl-2H-triazol-4-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 123373018 |
| Molecular Formula | C14H15N5O3 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 3-[1-(1,3-benzoxazol-2-ylmethyl)-3-methyl-2H-triazol-4-yl]-N-hydroxyprop-2-enamide |
| SMILES | CN1NN(Cc2nc3ccccc3o2)C=C1C=CC(=O)NO |
| InChI | InChI=1S/C14H15N5O3/c1-18-10(6-7-13(20)16-21)8-19(17-18)9-14-15-11-4-2-3-5-12(11)22-14/h2-8,17,21H,9H2,1H3,(H,16,20) |
| InChIKey | LZIGBWXFNRCLTG-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|