About 5-[3-(4-butan-2-yloxypyrimidin-2-yl)-1H-indol-5-yl]-N-propan-2-yl-1,3,4-oxadiazol-2-amine
5-[3-(4-butan-2-yloxypyrimidin-2-yl)-1H-indol-5-yl]-N-propan-2-yl-1,3,4-oxadiazol-2-amine (PubChem CID 123373159) has the molecular formula C21H24N6O2
and a molecular weight of 392.46 g/mol. Its IUPAC name is 5-[3-(4-butan-2-yloxypyrimidin-2-yl)-1H-indol-5-yl]-N-propan-2-yl-1,3,4-oxadiazol-2-amine.
Molecular Properties
| Compound Name | 5-[3-(4-butan-2-yloxypyrimidin-2-yl)-1H-indol-5-yl]-N-propan-2-yl-1,3,4-oxadiazol-2-amine |
| PubChem CID | 123373159 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 5-[3-(4-butan-2-yloxypyrimidin-2-yl)-1H-indol-5-yl]-N-propan-2-yl-1,3,4-oxadiazol-2-amine |
| SMILES | CCC(C)Oc1ccnc(-c2c[nH]c3ccc(-c4nnc(NC(C)C)o4)cc23)n1 |
| InChI | InChI=1S/C21H24N6O2/c1-5-13(4)28-18-8-9-22-19(25-18)16-11-23-17-7-6-14(10-15(16)17)20-26-27-21(29-20)24-12(2)3/h6-13,23H,5H2,1-4H3,(H,24,27) |
| InChIKey | UHGYRIWEYVLTLN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 101.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[3-(4-butan-2-yloxypyrimidin-2-yl)-1H-indol-5-yl]-N-propan-2-yl-1,3,4-oxadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(4-butan-2-yloxypyrimidin-2-yl)-1H-indol-5-yl]-N-propan-2-yl-1,3,4-oxadiazol-2-amine?
The IUPAC name of 5-[3-(4-butan-2-yloxypyrimidin-2-yl)-1H-indol-5-yl]-N-propan-2-yl-1,3,4-oxadiazol-2-amine (CID 123373159) is 5-[3-(4-butan-2-yloxypyrimidin-2-yl)-1H-indol-5-yl]-N-propan-2-yl-1,3,4-oxadiazol-2-amine.
What is the SMILES notation for 5-[3-(4-butan-2-yloxypyrimidin-2-yl)-1H-indol-5-yl]-N-propan-2-yl-1,3,4-oxadiazol-2-amine?
The canonical SMILES for 5-[3-(4-butan-2-yloxypyrimidin-2-yl)-1H-indol-5-yl]-N-propan-2-yl-1,3,4-oxadiazol-2-amine is CCC(C)Oc1ccnc(-c2c[nH]c3ccc(-c4nnc(NC(C)C)o4)cc23)n1.
What is the InChIKey of 5-[3-(4-butan-2-yloxypyrimidin-2-yl)-1H-indol-5-yl]-N-propan-2-yl-1,3,4-oxadiazol-2-amine?
The InChIKey is UHGYRIWEYVLTLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N6O2/c1-5-13(4)28-18-8-9-22-19(25-18)16-11-23-17-7-6-14(10-15(16)17)20-26-27-21(29-20)24-12(2)3/h6-13,23H,5H2,1-4H3,(H,24,27).
What are the key properties of 5-[3-(4-butan-2-yloxypyrimidin-2-yl)-1H-indol-5-yl]-N-propan-2-yl-1,3,4-oxadiazol-2-amine?
5-[3-(4-butan-2-yloxypyrimidin-2-yl)-1H-indol-5-yl]-N-propan-2-yl-1,3,4-oxadiazol-2-amine has a molecular weight of 392.46 g/mol, XLogP of 4.67, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(4-butan-2-yloxypyrimidin-2-yl)-1H-indol-5-yl]-N-propan-2-yl-1,3,4-oxadiazol-2-amine is sourced from PubChem (CID 123373159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).