About 2,6-dimethyl-1-aza-4-azoniacyclohepta-5,7-dien-3-yne
2,6-dimethyl-1-aza-4-azoniacyclohepta-5,7-dien-3-yne (PubChem CID 123374014) has the molecular formula C7H9N2+
and a molecular weight of 121.16 g/mol. Its IUPAC name is 2,6-dimethyl-1-aza-4-azoniacyclohepta-5,7-dien-3-yne.
Molecular Properties
| Compound Name | 2,6-dimethyl-1-aza-4-azoniacyclohepta-5,7-dien-3-yne |
| PubChem CID | 123374014 |
| Molecular Formula | C7H9N2+ |
| Molecular Weight | 121.16 g/mol |
| Exact Mass | 121.08 |
| IUPAC Name | 2,6-dimethyl-1-aza-4-azoniacyclohepta-5,7-dien-3-yne |
| SMILES | CC1=C[N+]#CC(C)N=C1 |
| InChI | InChI=1S/C7H9N2/c1-6-3-8-5-7(2)9-4-6/h3-4,7H,1-2H3/q+1 |
| InChIKey | NCFRPOSFYZYQEA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 16.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.16 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6-dimethyl-1-aza-4-azoniacyclohepta-5,7-dien-3-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-1-aza-4-azoniacyclohepta-5,7-dien-3-yne?
The IUPAC name of 2,6-dimethyl-1-aza-4-azoniacyclohepta-5,7-dien-3-yne (CID 123374014) is 2,6-dimethyl-1-aza-4-azoniacyclohepta-5,7-dien-3-yne.
What is the SMILES notation for 2,6-dimethyl-1-aza-4-azoniacyclohepta-5,7-dien-3-yne?
The canonical SMILES for 2,6-dimethyl-1-aza-4-azoniacyclohepta-5,7-dien-3-yne is CC1=C[N+]#CC(C)N=C1.
What is the InChIKey of 2,6-dimethyl-1-aza-4-azoniacyclohepta-5,7-dien-3-yne?
The InChIKey is NCFRPOSFYZYQEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N2/c1-6-3-8-5-7(2)9-4-6/h3-4,7H,1-2H3/q+1.
What are the key properties of 2,6-dimethyl-1-aza-4-azoniacyclohepta-5,7-dien-3-yne?
2,6-dimethyl-1-aza-4-azoniacyclohepta-5,7-dien-3-yne has a molecular weight of 121.16 g/mol, XLogP of 1.70, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-1-aza-4-azoniacyclohepta-5,7-dien-3-yne is sourced from PubChem (CID 123374014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).