C27H26FN3O3S — CID 123374088
N-(4-ethoxyphenyl)-2-[3-[2-(2-fluorophenyl)ethyl]-5-hydroxy-1-phenyl-2-sulfanylideneimidazol-4-yl]acetamide (PubChem CID 123374088) has the molecular formula C27H26FN3O3S and a molecular weight of 491.59 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[3-[2-(2-fluorophenyl)ethyl]-5-hydroxy-1-phenyl-2-sulfanylideneimidazol-4-yl]acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[3-[2-(2-fluorophenyl)ethyl]-5-hydroxy-1-phenyl-2-sulfanylideneimidazol-4-yl]acetamide |
|---|---|
| PubChem CID | 123374088 |
| Molecular Formula | C27H26FN3O3S |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[3-[2-(2-fluorophenyl)ethyl]-5-hydroxy-1-phenyl-2-sulfanylideneimidazol-4-yl]acetamide |
| SMILES | CCOc1ccc(NC(=O)Cc2c(O)n(-c3ccccc3)c(=S)n2CCc2ccccc2F)cc1 |
| InChI | InChI=1S/C27H26FN3O3S/c1-2-34-22-14-12-20(13-15-22)29-25(32)18-24-26(33)31(21-9-4-3-5-10-21)27(35)30(24)17-16-19-8-6-7-11-23(19)28/h3-15,33H,2,16-18H2,1H3,(H,29,32) |
| InChIKey | LNECYBLHMNZXGC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 68.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|