About (Z)-2-(2,3-dimethylbutylideneamino)ethenamine
(Z)-2-(2,3-dimethylbutylideneamino)ethenamine (PubChem CID 123374523) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is (Z)-2-(2,3-dimethylbutylideneamino)ethenamine.
Molecular Properties
| Compound Name | (Z)-2-(2,3-dimethylbutylideneamino)ethenamine |
| PubChem CID | 123374523 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (Z)-2-(2,3-dimethylbutylideneamino)ethenamine |
| SMILES | CC(C)C(C)/C=N/C=C\N |
| InChI | InChI=1S/C8H16N2/c1-7(2)8(3)6-10-5-4-9/h4-8H,9H2,1-3H3/b5-4-,10-6+ |
| InChIKey | OUTBSWMGIXLXOP-VWJYOPCBSA-N |
| XLogP | 1.78 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(2,3-dimethylbutylideneamino)ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(2,3-dimethylbutylideneamino)ethenamine?
The IUPAC name of (Z)-2-(2,3-dimethylbutylideneamino)ethenamine (CID 123374523) is (Z)-2-(2,3-dimethylbutylideneamino)ethenamine.
What is the SMILES notation for (Z)-2-(2,3-dimethylbutylideneamino)ethenamine?
The canonical SMILES for (Z)-2-(2,3-dimethylbutylideneamino)ethenamine is CC(C)C(C)/C=N/C=C\N.
What is the InChIKey of (Z)-2-(2,3-dimethylbutylideneamino)ethenamine?
The InChIKey is OUTBSWMGIXLXOP-VWJYOPCBSA-N. The full InChI is InChI=1S/C8H16N2/c1-7(2)8(3)6-10-5-4-9/h4-8H,9H2,1-3H3/b5-4-,10-6+.
What are the key properties of (Z)-2-(2,3-dimethylbutylideneamino)ethenamine?
(Z)-2-(2,3-dimethylbutylideneamino)ethenamine has a molecular weight of 140.23 g/mol, XLogP of 1.78, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(2,3-dimethylbutylideneamino)ethenamine is sourced from PubChem (CID 123374523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).