About 5-cyclobutyl-2-hydroxy-1,5-dimethyl-3-phenacylimidazolidin-4-one
5-cyclobutyl-2-hydroxy-1,5-dimethyl-3-phenacylimidazolidin-4-one (PubChem CID 123374674) has the molecular formula C17H22N2O3
and a molecular weight of 302.37 g/mol. Its IUPAC name is 5-cyclobutyl-2-hydroxy-1,5-dimethyl-3-phenacylimidazolidin-4-one.
Molecular Properties
| Compound Name | 5-cyclobutyl-2-hydroxy-1,5-dimethyl-3-phenacylimidazolidin-4-one |
| PubChem CID | 123374674 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 5-cyclobutyl-2-hydroxy-1,5-dimethyl-3-phenacylimidazolidin-4-one |
| SMILES | CN1C(O)N(CC(=O)c2ccccc2)C(=O)C1(C)C1CCC1 |
| InChI | InChI=1S/C17H22N2O3/c1-17(13-9-6-10-13)15(21)19(16(22)18(17)2)11-14(20)12-7-4-3-5-8-12/h3-5,7-8,13,16,22H,6,9-11H2,1-2H3 |
| InChIKey | LDZRSCSYHXTBGP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-cyclobutyl-2-hydroxy-1,5-dimethyl-3-phenacylimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclobutyl-2-hydroxy-1,5-dimethyl-3-phenacylimidazolidin-4-one?
The IUPAC name of 5-cyclobutyl-2-hydroxy-1,5-dimethyl-3-phenacylimidazolidin-4-one (CID 123374674) is 5-cyclobutyl-2-hydroxy-1,5-dimethyl-3-phenacylimidazolidin-4-one.
What is the SMILES notation for 5-cyclobutyl-2-hydroxy-1,5-dimethyl-3-phenacylimidazolidin-4-one?
The canonical SMILES for 5-cyclobutyl-2-hydroxy-1,5-dimethyl-3-phenacylimidazolidin-4-one is CN1C(O)N(CC(=O)c2ccccc2)C(=O)C1(C)C1CCC1.
What is the InChIKey of 5-cyclobutyl-2-hydroxy-1,5-dimethyl-3-phenacylimidazolidin-4-one?
The InChIKey is LDZRSCSYHXTBGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O3/c1-17(13-9-6-10-13)15(21)19(16(22)18(17)2)11-14(20)12-7-4-3-5-8-12/h3-5,7-8,13,16,22H,6,9-11H2,1-2H3.
What are the key properties of 5-cyclobutyl-2-hydroxy-1,5-dimethyl-3-phenacylimidazolidin-4-one?
5-cyclobutyl-2-hydroxy-1,5-dimethyl-3-phenacylimidazolidin-4-one has a molecular weight of 302.37 g/mol, XLogP of 1.48, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclobutyl-2-hydroxy-1,5-dimethyl-3-phenacylimidazolidin-4-one is sourced from PubChem (CID 123374674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).