C12H25N5O3 — CID 123374675
[1-(4-amino-7-hydroxyheptyl)-2-oxo-1,3-diazinan-4-yl]urea (PubChem CID 123374675) has the molecular formula C12H25N5O3 and a molecular weight of 287.36 g/mol. Its IUPAC name is [1-(4-amino-7-hydroxyheptyl)-2-oxo-1,3-diazinan-4-yl]urea.
| Compound Name | [1-(4-amino-7-hydroxyheptyl)-2-oxo-1,3-diazinan-4-yl]urea |
|---|---|
| PubChem CID | 123374675 |
| Molecular Formula | C12H25N5O3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | [1-(4-amino-7-hydroxyheptyl)-2-oxo-1,3-diazinan-4-yl]urea |
| SMILES | NC(=O)NC1CCN(CCCC(N)CCCO)C(=O)N1 |
| InChI | InChI=1S/C12H25N5O3/c13-9(4-2-8-18)3-1-6-17-7-5-10(15-11(14)19)16-12(17)20/h9-10,18H,1-8,13H2,(H,16,20)(H3,14,15,19) |
| InChIKey | DBUKQDMWGWNJIT-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 133.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |