C14H19N — CID 123374748
N-[(3Z)-5,6-dimethylideneocta-1,3,7-trien-2-yl]butan-2-imine (PubChem CID 123374748) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is N-[(3Z)-5,6-dimethylideneocta-1,3,7-trien-2-yl]butan-2-imine.
| Compound Name | N-[(3Z)-5,6-dimethylideneocta-1,3,7-trien-2-yl]butan-2-imine |
|---|---|
| PubChem CID | 123374748 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | N-[(3Z)-5,6-dimethylideneocta-1,3,7-trien-2-yl]butan-2-imine |
| SMILES | C=CC(=C)C(=C)/C=C\C(=C)/N=C(\C)CC |
| InChI | InChI=1S/C14H19N/c1-7-11(3)12(4)9-10-14(6)15-13(5)8-2/h7,9-10H,1,3-4,6,8H2,2,5H3/b10-9-,15-13+ |
| InChIKey | MVUGJABEMZUECG-JZZUDSPYSA-N |
| XLogP | 4.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|