C26H47FN7O3+ — CID 123375656
4-[3-[[3,3-diamino-2-(3-fluoro-1-azoniatricyclo[5.2.2.11,7]dodecan-9-yl)propanoyl]amino]piperidin-4-yl]-N,N-dimethylmorpholine-2-carboxamide (PubChem CID 123375656) has the molecular formula C26H47FN7O3+ and a molecular weight of 524.71 g/mol. Its IUPAC name is 4-[3-[[3,3-diamino-2-(3-fluoro-1-azoniatricyclo[5.2.2.11,7]dodecan-9-yl)propanoyl]amino]piperidin-4-yl]-N,N-dimethylmorpholine-2-carboxamide.
| Compound Name | 4-[3-[[3,3-diamino-2-(3-fluoro-1-azoniatricyclo[5.2.2.11,7]dodecan-9-yl)propanoyl]amino]piperidin-4-yl]-N,N-dimethylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 123375656 |
| Molecular Formula | C26H47FN7O3+ |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.37 |
| IUPAC Name | 4-[3-[[3,3-diamino-2-(3-fluoro-1-azoniatricyclo[5.2.2.11,7]dodecan-9-yl)propanoyl]amino]piperidin-4-yl]-N,N-dimethylmorpholine-2-carboxamide |
| SMILES | CN(C)C(=O)C1CN(C2CCNCC2NC(=O)C(C(N)N)C2CC34CCCC(F)C[N+]2(CC3)C4)CCO1 |
| InChI | InChI=1S/C26H46FN7O3/c1-32(2)25(36)21-14-33(9-11-37-21)19-5-8-30-13-18(19)31-24(35)22(23(28)29)20-12-26-6-3-4-17(27)15-34(20,16-26)10-7-26/h17-23,30H,3-16,28-29H2,1-2H3/p+1 |
| InChIKey | FALBXOOGFUQOGX-UHFFFAOYSA-O |
| XLogP | -1.02 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|