C25H32F4N4O2Si — CID 123375833
2-[[5-[2-fluoro-4-[4-methyl-6-(2-methylpropoxy)-3-pyridinyl]phenyl]-3-(trifluoromethyl)-1,2,4-triazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 123375833) has the molecular formula C25H32F4N4O2Si and a molecular weight of 524.64 g/mol. Its IUPAC name is 2-[[5-[2-fluoro-4-[4-methyl-6-(2-methylpropoxy)-3-pyridinyl]phenyl]-3-(trifluoromethyl)-1,2,4-triazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-[2-fluoro-4-[4-methyl-6-(2-methylpropoxy)-3-pyridinyl]phenyl]-3-(trifluoromethyl)-1,2,4-triazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 123375833 |
| Molecular Formula | C25H32F4N4O2Si |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | 2-[[5-[2-fluoro-4-[4-methyl-6-(2-methylpropoxy)-3-pyridinyl]phenyl]-3-(trifluoromethyl)-1,2,4-triazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cc(OCC(C)C)ncc1-c1ccc(-c2nc(C(F)(F)F)nn2COCC[Si](C)(C)C)c(F)c1 |
| InChI | InChI=1S/C25H32F4N4O2Si/c1-16(2)14-35-22-11-17(3)20(13-30-22)18-7-8-19(21(26)12-18)23-31-24(25(27,28)29)32-33(23)15-34-9-10-36(4,5)6/h7-8,11-13,16H,9-10,14-15H2,1-6H3 |
| InChIKey | VLQPKXSWIFNPJN-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|