About 1-O-tert-butyl 5-O-methyl 2,2-bis(methylsilyloxy)pentanedioate
1-O-tert-butyl 5-O-methyl 2,2-bis(methylsilyloxy)pentanedioate (PubChem CID 123375883) has the molecular formula C12H26O6Si2
and a molecular weight of 322.51 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-methyl 2,2-bis(methylsilyloxy)pentanedioate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 5-O-methyl 2,2-bis(methylsilyloxy)pentanedioate |
| PubChem CID | 123375883 |
| Molecular Formula | C12H26O6Si2 |
| Molecular Weight | 322.51 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 1-O-tert-butyl 5-O-methyl 2,2-bis(methylsilyloxy)pentanedioate |
| SMILES | COC(=O)CCC(O[SiH2]C)(O[SiH2]C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H26O6Si2/c1-11(2,3)16-10(14)12(17-19-5,18-20-6)8-7-9(13)15-4/h7-8,19-20H2,1-6H3 |
| InChIKey | GFXOYTQMFBCDPW-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.51 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 5-O-methyl 2,2-bis(methylsilyloxy)pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 5-O-methyl 2,2-bis(methylsilyloxy)pentanedioate?
The IUPAC name of 1-O-tert-butyl 5-O-methyl 2,2-bis(methylsilyloxy)pentanedioate (CID 123375883) is 1-O-tert-butyl 5-O-methyl 2,2-bis(methylsilyloxy)pentanedioate.
What is the SMILES notation for 1-O-tert-butyl 5-O-methyl 2,2-bis(methylsilyloxy)pentanedioate?
The canonical SMILES for 1-O-tert-butyl 5-O-methyl 2,2-bis(methylsilyloxy)pentanedioate is COC(=O)CCC(O[SiH2]C)(O[SiH2]C)C(=O)OC(C)(C)C.
What is the InChIKey of 1-O-tert-butyl 5-O-methyl 2,2-bis(methylsilyloxy)pentanedioate?
The InChIKey is GFXOYTQMFBCDPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O6Si2/c1-11(2,3)16-10(14)12(17-19-5,18-20-6)8-7-9(13)15-4/h7-8,19-20H2,1-6H3.
What are the key properties of 1-O-tert-butyl 5-O-methyl 2,2-bis(methylsilyloxy)pentanedioate?
1-O-tert-butyl 5-O-methyl 2,2-bis(methylsilyloxy)pentanedioate has a molecular weight of 322.51 g/mol, XLogP of 0.27, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 5-O-methyl 2,2-bis(methylsilyloxy)pentanedioate is sourced from PubChem (CID 123375883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).