C20H31N3O5 — CID 123376124
tert-butyl N-[(3S,6S)-3-(N'-hydroxycarbamimidoyl)-6-(phenylmethoxymethyl)oxan-3-yl]-N-methylcarbamate (PubChem CID 123376124) has the molecular formula C20H31N3O5 and a molecular weight of 393.48 g/mol. Its IUPAC name is tert-butyl N-[(3S,6S)-3-(N'-hydroxycarbamimidoyl)-6-(phenylmethoxymethyl)oxan-3-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(3S,6S)-3-(N'-hydroxycarbamimidoyl)-6-(phenylmethoxymethyl)oxan-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 123376124 |
| Molecular Formula | C20H31N3O5 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | tert-butyl N-[(3S,6S)-3-(N'-hydroxycarbamimidoyl)-6-(phenylmethoxymethyl)oxan-3-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@]1(C(N)=NO)CC[C@@H](COCc2ccccc2)OC1 |
| InChI | InChI=1S/C20H31N3O5/c1-19(2,3)28-18(24)23(4)20(17(21)22-25)11-10-16(27-14-20)13-26-12-15-8-6-5-7-9-15/h5-9,16,25H,10-14H2,1-4H3,(H2,21,22)/t16-,20+/m0/s1 |
| InChIKey | XFKJGWJONMAUFV-OXJNMPFZSA-N |
| XLogP | 2.73 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|