C14H24N4O — CID 123376975
1-cyclopentyl-2-imino-3-methanimidoyl-4,6,6-trimethyl-1,4-diazepan-5-one (PubChem CID 123376975) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-cyclopentyl-2-imino-3-methanimidoyl-4,6,6-trimethyl-1,4-diazepan-5-one.
| Compound Name | 1-cyclopentyl-2-imino-3-methanimidoyl-4,6,6-trimethyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 123376975 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 1-cyclopentyl-2-imino-3-methanimidoyl-4,6,6-trimethyl-1,4-diazepan-5-one |
| SMILES | [H]/N=C/C1/C(=N\[H])N(C2CCCC2)CC(C)(C)C(=O)N1C |
| InChI | InChI=1S/C14H24N4O/c1-14(2)9-18(10-6-4-5-7-10)12(16)11(8-15)17(3)13(14)19/h8,10-11,15-16H,4-7,9H2,1-3H3/b15-8+,16-12+ |
| InChIKey | HTBIMQBKWYSOEK-HLETWVSPSA-N |
| XLogP | 1.72 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|