About methyl N'-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methylcarbamoyl]carbamimidothioate
methyl N'-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methylcarbamoyl]carbamimidothioate (PubChem CID 123377786) has the molecular formula C8H9F3N4OS2
and a molecular weight of 298.32 g/mol. Its IUPAC name is methyl N'-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methylcarbamoyl]carbamimidothioate.
Molecular Properties
| Compound Name | methyl N'-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methylcarbamoyl]carbamimidothioate |
| PubChem CID | 123377786 |
| Molecular Formula | C8H9F3N4OS2 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | methyl N'-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methylcarbamoyl]carbamimidothioate |
| SMILES | CSC(N)=NC(=O)NCc1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C8H9F3N4OS2/c1-17-6(12)15-7(16)14-3-4-2-13-5(18-4)8(9,10)11/h2H,3H2,1H3,(H3,12,14,15,16) |
| InChIKey | SOAPOGPPWSDNJF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N'-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methylcarbamoyl]carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N'-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methylcarbamoyl]carbamimidothioate?
The IUPAC name of methyl N'-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methylcarbamoyl]carbamimidothioate (CID 123377786) is methyl N'-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methylcarbamoyl]carbamimidothioate.
What is the SMILES notation for methyl N'-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methylcarbamoyl]carbamimidothioate?
The canonical SMILES for methyl N'-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methylcarbamoyl]carbamimidothioate is CSC(N)=NC(=O)NCc1cnc(C(F)(F)F)s1.
What is the InChIKey of methyl N'-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methylcarbamoyl]carbamimidothioate?
The InChIKey is SOAPOGPPWSDNJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N4OS2/c1-17-6(12)15-7(16)14-3-4-2-13-5(18-4)8(9,10)11/h2H,3H2,1H3,(H3,12,14,15,16).
What are the key properties of methyl N'-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methylcarbamoyl]carbamimidothioate?
methyl N'-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methylcarbamoyl]carbamimidothioate has a molecular weight of 298.32 g/mol, XLogP of 2.05, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N'-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methylcarbamoyl]carbamimidothioate is sourced from PubChem (CID 123377786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).