About (4-fluorophenyl)methyl N-[2-(3-aminophenyl)ethyl]-N-tert-butylcarbamate
(4-fluorophenyl)methyl N-[2-(3-aminophenyl)ethyl]-N-tert-butylcarbamate (PubChem CID 123377912) has the molecular formula C20H25FN2O2
and a molecular weight of 344.43 g/mol. Its IUPAC name is (4-fluorophenyl)methyl N-[2-(3-aminophenyl)ethyl]-N-tert-butylcarbamate.
Molecular Properties
| Compound Name | (4-fluorophenyl)methyl N-[2-(3-aminophenyl)ethyl]-N-tert-butylcarbamate |
| PubChem CID | 123377912 |
| Molecular Formula | C20H25FN2O2 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | (4-fluorophenyl)methyl N-[2-(3-aminophenyl)ethyl]-N-tert-butylcarbamate |
| SMILES | CC(C)(C)N(CCc1cccc(N)c1)C(=O)OCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H25FN2O2/c1-20(2,3)23(12-11-15-5-4-6-18(22)13-15)19(24)25-14-16-7-9-17(21)10-8-16/h4-10,13H,11-12,14,22H2,1-3H3 |
| InChIKey | YYICKJOSWSQWGC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-fluorophenyl)methyl N-[2-(3-aminophenyl)ethyl]-N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl)methyl N-[2-(3-aminophenyl)ethyl]-N-tert-butylcarbamate?
The IUPAC name of (4-fluorophenyl)methyl N-[2-(3-aminophenyl)ethyl]-N-tert-butylcarbamate (CID 123377912) is (4-fluorophenyl)methyl N-[2-(3-aminophenyl)ethyl]-N-tert-butylcarbamate.
What is the SMILES notation for (4-fluorophenyl)methyl N-[2-(3-aminophenyl)ethyl]-N-tert-butylcarbamate?
The canonical SMILES for (4-fluorophenyl)methyl N-[2-(3-aminophenyl)ethyl]-N-tert-butylcarbamate is CC(C)(C)N(CCc1cccc(N)c1)C(=O)OCc1ccc(F)cc1.
What is the InChIKey of (4-fluorophenyl)methyl N-[2-(3-aminophenyl)ethyl]-N-tert-butylcarbamate?
The InChIKey is YYICKJOSWSQWGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25FN2O2/c1-20(2,3)23(12-11-15-5-4-6-18(22)13-15)19(24)25-14-16-7-9-17(21)10-8-16/h4-10,13H,11-12,14,22H2,1-3H3.
What are the key properties of (4-fluorophenyl)methyl N-[2-(3-aminophenyl)ethyl]-N-tert-butylcarbamate?
(4-fluorophenyl)methyl N-[2-(3-aminophenyl)ethyl]-N-tert-butylcarbamate has a molecular weight of 344.43 g/mol, XLogP of 4.39, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)methyl N-[2-(3-aminophenyl)ethyl]-N-tert-butylcarbamate is sourced from PubChem (CID 123377912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).