About 1-bromo-4-(nitrosomethyl)-2-(2,2,2-trifluoroethyl)benzene
1-bromo-4-(nitrosomethyl)-2-(2,2,2-trifluoroethyl)benzene (PubChem CID 123378007) has the molecular formula C9H7BrF3NO
and a molecular weight of 282.06 g/mol. Its IUPAC name is 1-bromo-4-(nitrosomethyl)-2-(2,2,2-trifluoroethyl)benzene.
Molecular Properties
| Compound Name | 1-bromo-4-(nitrosomethyl)-2-(2,2,2-trifluoroethyl)benzene |
| PubChem CID | 123378007 |
| Molecular Formula | C9H7BrF3NO |
| Molecular Weight | 282.06 g/mol |
| Exact Mass | 280.97 |
| IUPAC Name | 1-bromo-4-(nitrosomethyl)-2-(2,2,2-trifluoroethyl)benzene |
| SMILES | O=NCc1ccc(Br)c(CC(F)(F)F)c1 |
| InChI | InChI=1S/C9H7BrF3NO/c10-8-2-1-6(5-14-15)3-7(8)4-9(11,12)13/h1-3H,4-5H2 |
| InChIKey | DFEQZKDJOUITMY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.06 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-bromo-4-(nitrosomethyl)-2-(2,2,2-trifluoroethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-(nitrosomethyl)-2-(2,2,2-trifluoroethyl)benzene?
The IUPAC name of 1-bromo-4-(nitrosomethyl)-2-(2,2,2-trifluoroethyl)benzene (CID 123378007) is 1-bromo-4-(nitrosomethyl)-2-(2,2,2-trifluoroethyl)benzene.
What is the SMILES notation for 1-bromo-4-(nitrosomethyl)-2-(2,2,2-trifluoroethyl)benzene?
The canonical SMILES for 1-bromo-4-(nitrosomethyl)-2-(2,2,2-trifluoroethyl)benzene is O=NCc1ccc(Br)c(CC(F)(F)F)c1.
What is the InChIKey of 1-bromo-4-(nitrosomethyl)-2-(2,2,2-trifluoroethyl)benzene?
The InChIKey is DFEQZKDJOUITMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrF3NO/c10-8-2-1-6(5-14-15)3-7(8)4-9(11,12)13/h1-3H,4-5H2.
What are the key properties of 1-bromo-4-(nitrosomethyl)-2-(2,2,2-trifluoroethyl)benzene?
1-bromo-4-(nitrosomethyl)-2-(2,2,2-trifluoroethyl)benzene has a molecular weight of 282.06 g/mol, XLogP of 3.82, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-(nitrosomethyl)-2-(2,2,2-trifluoroethyl)benzene is sourced from PubChem (CID 123378007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).