About [4-[[(E)-5-imino-2,4-dimethylhex-2-enyl]amino]-2-(trifluoromethyl)phenyl]methanol
[4-[[(E)-5-imino-2,4-dimethylhex-2-enyl]amino]-2-(trifluoromethyl)phenyl]methanol (PubChem CID 123378071) has the molecular formula C16H21F3N2O
and a molecular weight of 314.35 g/mol. Its IUPAC name is [4-[[(E)-5-imino-2,4-dimethylhex-2-enyl]amino]-2-(trifluoromethyl)phenyl]methanol.
Molecular Properties
| Compound Name | [4-[[(E)-5-imino-2,4-dimethylhex-2-enyl]amino]-2-(trifluoromethyl)phenyl]methanol |
| PubChem CID | 123378071 |
| Molecular Formula | C16H21F3N2O |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | [4-[[(E)-5-imino-2,4-dimethylhex-2-enyl]amino]-2-(trifluoromethyl)phenyl]methanol |
| SMILES | [H]/N=C(\C)C(C)/C=C(\C)CNc1ccc(CO)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H21F3N2O/c1-10(6-11(2)12(3)20)8-21-14-5-4-13(9-22)15(7-14)16(17,18)19/h4-7,11,20-22H,8-9H2,1-3H3/b10-6+,20-12+ |
| InChIKey | ZGUUUWPXCQNTKY-UPINRHINSA-N |
| XLogP | 4.23 |
| TPSA | 56.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [4-[[(E)-5-imino-2,4-dimethylhex-2-enyl]amino]-2-(trifluoromethyl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[(E)-5-imino-2,4-dimethylhex-2-enyl]amino]-2-(trifluoromethyl)phenyl]methanol?
The IUPAC name of [4-[[(E)-5-imino-2,4-dimethylhex-2-enyl]amino]-2-(trifluoromethyl)phenyl]methanol (CID 123378071) is [4-[[(E)-5-imino-2,4-dimethylhex-2-enyl]amino]-2-(trifluoromethyl)phenyl]methanol.
What is the SMILES notation for [4-[[(E)-5-imino-2,4-dimethylhex-2-enyl]amino]-2-(trifluoromethyl)phenyl]methanol?
The canonical SMILES for [4-[[(E)-5-imino-2,4-dimethylhex-2-enyl]amino]-2-(trifluoromethyl)phenyl]methanol is [H]/N=C(\C)C(C)/C=C(\C)CNc1ccc(CO)c(C(F)(F)F)c1.
What is the InChIKey of [4-[[(E)-5-imino-2,4-dimethylhex-2-enyl]amino]-2-(trifluoromethyl)phenyl]methanol?
The InChIKey is ZGUUUWPXCQNTKY-UPINRHINSA-N. The full InChI is InChI=1S/C16H21F3N2O/c1-10(6-11(2)12(3)20)8-21-14-5-4-13(9-22)15(7-14)16(17,18)19/h4-7,11,20-22H,8-9H2,1-3H3/b10-6+,20-12+.
What are the key properties of [4-[[(E)-5-imino-2,4-dimethylhex-2-enyl]amino]-2-(trifluoromethyl)phenyl]methanol?
[4-[[(E)-5-imino-2,4-dimethylhex-2-enyl]amino]-2-(trifluoromethyl)phenyl]methanol has a molecular weight of 314.35 g/mol, XLogP of 4.23, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[(E)-5-imino-2,4-dimethylhex-2-enyl]amino]-2-(trifluoromethyl)phenyl]methanol is sourced from PubChem (CID 123378071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).